C22H22ClFN2O3S — CID 126235858
(5E)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 126235858) has the molecular formula C22H22ClFN2O3S and a molecular weight of 448.95 g/mol. Its IUPAC name is (5E)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126235858 |
| Molecular Formula | C22H22ClFN2O3S |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | (5E)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3ccc(F)cc3)N(CC)C2=O)cc(Cl)c1OCC |
| InChI | InChI=1S/C22H22ClFN2O3S/c1-4-26-21(27)19(30-22(26)25-16-9-7-15(24)8-10-16)13-14-11-17(23)20(29-6-3)18(12-14)28-5-2/h7-13H,4-6H2,1-3H3/b19-13+,25-22- |
| InChIKey | SOTQYZJOVJSZQX-ZVERUENYSA-N |
| XLogP | 5.90 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|