C28H26Cl2N2O4S — CID 126249052
(5E)-5-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 126249052) has the molecular formula C28H26Cl2N2O4S and a molecular weight of 557.50 g/mol. Its IUPAC name is (5E)-5-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126249052 |
| Molecular Formula | C28H26Cl2N2O4S |
| Molecular Weight | 557.50 g/mol |
| Exact Mass | 556.10 |
| IUPAC Name | (5E)-5-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3ccc(OC)cc3)N(CC)C2=O)cc(Cl)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H26Cl2N2O4S/c1-4-32-27(33)25(37-28(32)31-21-10-12-22(34-3)13-11-21)16-19-14-23(30)26(24(15-19)35-5-2)36-17-18-6-8-20(29)9-7-18/h6-16H,4-5,17H2,1-3H3/b25-16+,31-28- |
| InChIKey | WIXABOJVYUBOAD-NGAICIKJSA-N |
| XLogP | 7.60 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.50 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|