C26H22Br2N2O3S — CID 126247447
(5E)-5-[(3,5-dibromo-4-phenylmethoxyphenyl)methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 126247447) has the molecular formula C26H22Br2N2O3S and a molecular weight of 602.35 g/mol. Its IUPAC name is (5E)-5-[(3,5-dibromo-4-phenylmethoxyphenyl)methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3,5-dibromo-4-phenylmethoxyphenyl)methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126247447 |
| Molecular Formula | C26H22Br2N2O3S |
| Molecular Weight | 602.35 g/mol |
| Exact Mass | 599.97 |
| IUPAC Name | (5E)-5-[(3,5-dibromo-4-phenylmethoxyphenyl)methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2cc(Br)c(OCc3ccccc3)c(Br)c2)S/C1=N\c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H22Br2N2O3S/c1-3-30-25(31)23(34-26(30)29-19-9-11-20(32-2)12-10-19)15-18-13-21(27)24(22(28)14-18)33-16-17-7-5-4-6-8-17/h4-15H,3,16H2,1-2H3/b23-15+,29-26- |
| InChIKey | JWORBZKJCGGZDV-IQUJYTIYSA-N |
| XLogP | 7.42 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.35 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|