C26H21Br2FN2O3S — CID 126244991
(5E)-5-[[3,5-dibromo-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 126244991) has the molecular formula C26H21Br2FN2O3S and a molecular weight of 620.34 g/mol. Its IUPAC name is (5E)-5-[[3,5-dibromo-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[3,5-dibromo-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126244991 |
| Molecular Formula | C26H21Br2FN2O3S |
| Molecular Weight | 620.34 g/mol |
| Exact Mass | 617.96 |
| IUPAC Name | (5E)-5-[[3,5-dibromo-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2cc(Br)c(OCc3ccccc3F)c(Br)c2)S/C1=N\c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H21Br2FN2O3S/c1-3-31-25(32)23(35-26(31)30-18-8-10-19(33-2)11-9-18)14-16-12-20(27)24(21(28)13-16)34-15-17-6-4-5-7-22(17)29/h4-14H,3,15H2,1-2H3/b23-14+,30-26- |
| InChIKey | LJFMGXQQHVUJBW-VVYOYBAHSA-N |
| XLogP | 7.56 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.34 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|