C22H21BrN2O6S — CID 126245501
2-[2-bromo-4-[(E)-[3-ethyl-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid (PubChem CID 126245501) has the molecular formula C22H21BrN2O6S and a molecular weight of 521.39 g/mol. Its IUPAC name is 2-[2-bromo-4-[(E)-[3-ethyl-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-bromo-4-[(E)-[3-ethyl-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126245501 |
| Molecular Formula | C22H21BrN2O6S |
| Molecular Weight | 521.39 g/mol |
| Exact Mass | 520.03 |
| IUPAC Name | 2-[2-bromo-4-[(E)-[3-ethyl-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid |
| SMILES | CCN1C(=O)/C(=C\c2cc(Br)c(OCC(=O)O)c(OC)c2)S/C1=N\c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H21BrN2O6S/c1-4-25-21(28)18(32-22(25)24-14-5-7-15(29-2)8-6-14)11-13-9-16(23)20(17(10-13)30-3)31-12-19(26)27/h5-11H,4,12H2,1-3H3,(H,26,27)/b18-11+,24-22- |
| InChIKey | MQSBLPBGMWBEJC-DLIIZKKJSA-N |
| XLogP | 4.55 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|