C24H25BrN2O4S — CID 126258053
(5E)-5-[(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 126258053) has the molecular formula C24H25BrN2O4S and a molecular weight of 517.45 g/mol. Its IUPAC name is (5E)-5-[(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126258053 |
| Molecular Formula | C24H25BrN2O4S |
| Molecular Weight | 517.45 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | (5E)-5-[(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | C=CCOc1c(Br)cc(/C=C2/S/C(=N\c3ccc(OC)cc3)N(CC)C2=O)cc1OCC |
| InChI | InChI=1S/C24H25BrN2O4S/c1-5-12-31-22-19(25)13-16(14-20(22)30-7-3)15-21-23(28)27(6-2)24(32-21)26-17-8-10-18(29-4)11-9-17/h5,8-11,13-15H,1,6-7,12H2,2-4H3/b21-15+,26-24- |
| InChIKey | QUQQLRGTTALSMW-BYCOAOMCSA-N |
| XLogP | 6.05 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.45 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|