C21H19Br2ClN2O3S — CID 126025215
(5E)-2-(4-bromo-3-chlorophenyl)imino-5-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylidene]-3-ethyl-1,3-thiazolidin-4-one (PubChem CID 126025215) has the molecular formula C21H19Br2ClN2O3S and a molecular weight of 574.72 g/mol. Its IUPAC name is (5E)-2-(4-bromo-3-chlorophenyl)imino-5-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylidene]-3-ethyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(4-bromo-3-chlorophenyl)imino-5-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylidene]-3-ethyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126025215 |
| Molecular Formula | C21H19Br2ClN2O3S |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 571.92 |
| IUPAC Name | (5E)-2-(4-bromo-3-chlorophenyl)imino-5-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylidene]-3-ethyl-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3ccc(Br)c(Cl)c3)N(CC)C2=O)cc(Br)c1OC |
| InChI | InChI=1S/C21H19Br2ClN2O3S/c1-4-26-20(27)18(30-21(26)25-13-6-7-14(22)16(24)11-13)10-12-8-15(23)19(28-3)17(9-12)29-5-2/h6-11H,4-5H2,1-3H3/b18-10+,25-21- |
| InChIKey | XJYLBAZFEXWLKX-ALNLHIHKSA-N |
| XLogP | 6.90 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|