C23H24BrClN2O3S — CID 126087249
(5Z)-5-[(3-bromo-4,5-diethoxyphenyl)methylidene]-2-(4-chlorophenyl)imino-3-propyl-1,3-thiazolidin-4-one (PubChem CID 126087249) has the molecular formula C23H24BrClN2O3S and a molecular weight of 523.88 g/mol. Its IUPAC name is (5Z)-5-[(3-bromo-4,5-diethoxyphenyl)methylidene]-2-(4-chlorophenyl)imino-3-propyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-bromo-4,5-diethoxyphenyl)methylidene]-2-(4-chlorophenyl)imino-3-propyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126087249 |
| Molecular Formula | C23H24BrClN2O3S |
| Molecular Weight | 523.88 g/mol |
| Exact Mass | 522.04 |
| IUPAC Name | (5Z)-5-[(3-bromo-4,5-diethoxyphenyl)methylidene]-2-(4-chlorophenyl)imino-3-propyl-1,3-thiazolidin-4-one |
| SMILES | CCCN1C(=O)/C(=C/c2cc(Br)c(OCC)c(OCC)c2)S/C1=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H24BrClN2O3S/c1-4-11-27-22(28)20(31-23(27)26-17-9-7-16(25)8-10-17)14-15-12-18(24)21(30-6-3)19(13-15)29-5-2/h7-10,12-14H,4-6,11H2,1-3H3/b20-14-,26-23+ |
| InChIKey | OHZURLPQIRNIMB-URWIEHKQSA-N |
| XLogP | 6.91 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.88 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|