C22H21BrClIN2O3S — CID 126019653
(5E)-2-(4-bromo-3-chlorophenyl)imino-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-3-ethyl-1,3-thiazolidin-4-one (PubChem CID 126019653) has the molecular formula C22H21BrClIN2O3S and a molecular weight of 635.75 g/mol. Its IUPAC name is (5E)-2-(4-bromo-3-chlorophenyl)imino-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-3-ethyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(4-bromo-3-chlorophenyl)imino-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-3-ethyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126019653 |
| Molecular Formula | C22H21BrClIN2O3S |
| Molecular Weight | 635.75 g/mol |
| Exact Mass | 633.92 |
| IUPAC Name | (5E)-2-(4-bromo-3-chlorophenyl)imino-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-3-ethyl-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3ccc(Br)c(Cl)c3)N(CC)C2=O)cc(I)c1OCC |
| InChI | InChI=1S/C22H21BrClIN2O3S/c1-4-27-21(28)19(31-22(27)26-14-7-8-15(23)16(24)12-14)11-13-9-17(25)20(30-6-3)18(10-13)29-5-2/h7-12H,4-6H2,1-3H3/b19-11+,26-22- |
| InChIKey | MDJGINDSTVYYIO-JBSVXOLYSA-N |
| XLogP | 7.13 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.75 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|