C24H23ClN2O3S — CID 126085819
(5Z)-2-(4-chlorophenyl)imino-5-[(3-ethoxy-4-prop-2-ynoxyphenyl)methylidene]-3-propyl-1,3-thiazolidin-4-one (PubChem CID 126085819) has the molecular formula C24H23ClN2O3S and a molecular weight of 454.98 g/mol. Its IUPAC name is (5Z)-2-(4-chlorophenyl)imino-5-[(3-ethoxy-4-prop-2-ynoxyphenyl)methylidene]-3-propyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-chlorophenyl)imino-5-[(3-ethoxy-4-prop-2-ynoxyphenyl)methylidene]-3-propyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126085819 |
| Molecular Formula | C24H23ClN2O3S |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | (5Z)-2-(4-chlorophenyl)imino-5-[(3-ethoxy-4-prop-2-ynoxyphenyl)methylidene]-3-propyl-1,3-thiazolidin-4-one |
| SMILES | C#CCOc1ccc(/C=C2\S/C(=N/c3ccc(Cl)cc3)N(CCC)C2=O)cc1OCC |
| InChI | InChI=1S/C24H23ClN2O3S/c1-4-13-27-23(28)22(31-24(27)26-19-10-8-18(25)9-11-19)16-17-7-12-20(30-14-5-2)21(15-17)29-6-3/h2,7-12,15-16H,4,6,13-14H2,1,3H3/b22-16-,26-24+ |
| InChIKey | GAPOYCDLCRXTQM-SGXAETBLSA-N |
| XLogP | 5.76 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|