C21H20BrClN2O3S — CID 126097993
(5Z)-5-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2-(4-chlorophenyl)imino-3-propyl-1,3-thiazolidin-4-one (PubChem CID 126097993) has the molecular formula C21H20BrClN2O3S and a molecular weight of 495.83 g/mol. Its IUPAC name is (5Z)-5-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2-(4-chlorophenyl)imino-3-propyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2-(4-chlorophenyl)imino-3-propyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126097993 |
| Molecular Formula | C21H20BrClN2O3S |
| Molecular Weight | 495.83 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | (5Z)-5-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2-(4-chlorophenyl)imino-3-propyl-1,3-thiazolidin-4-one |
| SMILES | CCCN1C(=O)/C(=C/c2cc(Br)c(O)c(OCC)c2)S/C1=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H20BrClN2O3S/c1-3-9-25-20(27)18(29-21(25)24-15-7-5-14(23)6-8-15)12-13-10-16(22)19(26)17(11-13)28-4-2/h5-8,10-12,26H,3-4,9H2,1-2H3/b18-12-,24-21+ |
| InChIKey | QWDICKATPXOKEP-FKHPOCDDSA-N |
| XLogP | 6.22 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.83 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|