C20H16BrClN2O5S — CID 126170577
2-[(5E)-5-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-chlorophenyl)acetamide (PubChem CID 126170577) has the molecular formula C20H16BrClN2O5S and a molecular weight of 511.78 g/mol. Its IUPAC name is 2-[(5E)-5-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[(5E)-5-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 126170577 |
| Molecular Formula | C20H16BrClN2O5S |
| Molecular Weight | 511.78 g/mol |
| Exact Mass | 509.97 |
| IUPAC Name | 2-[(5E)-5-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-chlorophenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccc(Cl)cc3)C2=O)cc(Br)c1O |
| InChI | InChI=1S/C20H16BrClN2O5S/c1-2-29-15-8-11(7-14(21)18(15)26)9-16-19(27)24(20(28)30-16)10-17(25)23-13-5-3-12(22)4-6-13/h3-9,26H,2,10H2,1H3,(H,23,25)/b16-9+ |
| InChIKey | GEBKJTFXTMVFOZ-CXUHLZMHSA-N |
| XLogP | 4.88 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.78 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|