C21H19BrN2O6S — CID 56691704
2-[(5Z)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 56691704) has the molecular formula C21H19BrN2O6S and a molecular weight of 507.36 g/mol. Its IUPAC name is 2-[(5Z)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 56691704 |
| Molecular Formula | C21H19BrN2O6S |
| Molecular Weight | 507.36 g/mol |
| Exact Mass | 506.01 |
| IUPAC Name | 2-[(5Z)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CN2C(=O)S/C(=C\c3cc(Br)c(O)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C21H19BrN2O6S/c1-3-30-14-6-4-13(5-7-14)23-18(25)11-24-20(27)17(31-21(24)28)10-12-8-15(22)19(26)16(9-12)29-2/h4-10,26H,3,11H2,1-2H3,(H,23,25)/b17-10- |
| InChIKey | SYRYAMMGDCBFID-YVLHZVERSA-N |
| XLogP | 4.24 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|