C25H27BrN2O6S — CID 126246582
2-[(5E)-5-[[3-bromo-4-[(2S)-butan-2-yl]oxy-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 126246582) has the molecular formula C25H27BrN2O6S and a molecular weight of 563.47 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-bromo-4-[(2S)-butan-2-yl]oxy-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[3-bromo-4-[(2S)-butan-2-yl]oxy-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126246582 |
| Molecular Formula | C25H27BrN2O6S |
| Molecular Weight | 563.47 g/mol |
| Exact Mass | 562.08 |
| IUPAC Name | 2-[(5E)-5-[[3-bromo-4-[(2S)-butan-2-yl]oxy-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccc(OC)cc3)C2=O)cc(Br)c1O[C@@H](C)CC |
| InChI | InChI=1S/C25H27BrN2O6S/c1-5-15(3)34-23-19(26)11-16(12-20(23)33-6-2)13-21-24(30)28(25(31)35-21)14-22(29)27-17-7-9-18(32-4)10-8-17/h7-13,15H,5-6,14H2,1-4H3,(H,27,29)/b21-13+/t15-/m0/s1 |
| InChIKey | KGXDLJAMBVLSMW-PCXKXAPESA-N |
| XLogP | 5.71 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.47 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|