C30H28BrN3O7S — CID 126103126
2-[(5E)-5-[[3-bromo-5-methoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 126103126) has the molecular formula C30H28BrN3O7S and a molecular weight of 654.54 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-bromo-5-methoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[3-bromo-5-methoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126103126 |
| Molecular Formula | C30H28BrN3O7S |
| Molecular Weight | 654.54 g/mol |
| Exact Mass | 653.08 |
| IUPAC Name | 2-[(5E)-5-[[3-bromo-5-methoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CN2C(=O)S/C(=C/c3cc(Br)c(OCC(=O)Nc4ccc(C)cc4)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C30H28BrN3O7S/c1-4-40-22-11-9-21(10-12-22)32-26(35)16-34-29(37)25(42-30(34)38)15-19-13-23(31)28(24(14-19)39-3)41-17-27(36)33-20-7-5-18(2)6-8-20/h5-15H,4,16-17H2,1-3H3,(H,32,35)(H,33,36)/b25-15+ |
| InChIKey | MANSQMXFELFRLK-MFKUBSTISA-N |
| XLogP | 5.86 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.54 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|