C29H32BrN3O6S — CID 4580381
2-[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-bromo-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 4580381) has the molecular formula C29H32BrN3O6S and a molecular weight of 630.56 g/mol. Its IUPAC name is 2-[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-bromo-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-bromo-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 4580381 |
| Molecular Formula | C29H32BrN3O6S |
| Molecular Weight | 630.56 g/mol |
| Exact Mass | 629.12 |
| IUPAC Name | 2-[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-bromo-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(C=C2SC(=O)N(CC(=O)N3CCCCCC3)C2=O)cc(Br)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C29H32BrN3O6S/c1-3-38-23-15-20(14-22(30)27(23)39-18-25(34)31-21-10-8-19(2)9-11-21)16-24-28(36)33(29(37)40-24)17-26(35)32-12-6-4-5-7-13-32/h8-11,14-16H,3-7,12-13,17-18H2,1-2H3,(H,31,34) |
| InChIKey | ICEUCVBUIKLTCR-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|