C27H28IN3O7S — CID 126148152
2-[2-ethoxy-6-iodo-4-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126148152) has the molecular formula C27H28IN3O7S and a molecular weight of 665.51 g/mol. Its IUPAC name is 2-[2-ethoxy-6-iodo-4-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-6-iodo-4-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126148152 |
| Molecular Formula | C27H28IN3O7S |
| Molecular Weight | 665.51 g/mol |
| Exact Mass | 665.07 |
| IUPAC Name | 2-[2-ethoxy-6-iodo-4-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)N3CCOCC3)C2=O)cc(I)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C27H28IN3O7S/c1-3-37-21-13-18(12-20(28)25(21)38-16-23(32)29-19-6-4-17(2)5-7-19)14-22-26(34)31(27(35)39-22)15-24(33)30-8-10-36-11-9-30/h4-7,12-14H,3,8-11,15-16H2,1-2H3,(H,29,32)/b22-14+ |
| InChIKey | KKUIVORPUFTYLA-HYARGMPZSA-N |
| XLogP | 3.91 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|