C31H28IN3O6S — CID 126383474
2-[4-[(Z)-[3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126383474) has the molecular formula C31H28IN3O6S and a molecular weight of 697.55 g/mol. Its IUPAC name is 2-[4-[(Z)-[3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-[(Z)-[3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126383474 |
| Molecular Formula | C31H28IN3O6S |
| Molecular Weight | 697.55 g/mol |
| Exact Mass | 697.07 |
| IUPAC Name | 2-[4-[(Z)-[3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | COc1cc(/C=C2\SC(=O)N(CC(=O)N3CCc4ccccc4C3)C2=O)cc(I)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C31H28IN3O6S/c1-19-7-9-23(10-8-19)33-27(36)18-41-29-24(32)13-20(14-25(29)40-2)15-26-30(38)35(31(39)42-26)17-28(37)34-12-11-21-5-3-4-6-22(21)16-34/h3-10,13-15H,11-12,16-18H2,1-2H3,(H,33,36)/b26-15- |
| InChIKey | TVSPCAJLPMFHPY-YSMPRRRNSA-N |
| XLogP | 5.25 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.55 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|