C30H25IN2O7S — CID 126386633
4-[[4-[(Z)-[3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126386633) has the molecular formula C30H25IN2O7S and a molecular weight of 684.51 g/mol. Its IUPAC name is 4-[[4-[(Z)-[3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(Z)-[3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126386633 |
| Molecular Formula | C30H25IN2O7S |
| Molecular Weight | 684.51 g/mol |
| Exact Mass | 684.04 |
| IUPAC Name | 4-[[4-[(Z)-[3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C2\SC(=O)N(CC(=O)N3CCc4ccccc4C3)C2=O)cc(I)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C30H25IN2O7S/c1-39-24-13-19(12-23(31)27(24)40-17-18-6-8-21(9-7-18)29(36)37)14-25-28(35)33(30(38)41-25)16-26(34)32-11-10-20-4-2-3-5-22(20)15-32/h2-9,12-14H,10-11,15-17H2,1H3,(H,36,37)/b25-14- |
| InChIKey | XPHRXDXDLXVWNC-QFEZKATASA-N |
| XLogP | 5.20 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|