C29H24I2N2O4S — CID 126393239
(5Z)-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-5-[[3,5-diiodo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126393239) has the molecular formula C29H24I2N2O4S and a molecular weight of 750.40 g/mol. Its IUPAC name is (5Z)-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-5-[[3,5-diiodo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-5-[[3,5-diiodo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126393239 |
| Molecular Formula | C29H24I2N2O4S |
| Molecular Weight | 750.40 g/mol |
| Exact Mass | 749.95 |
| IUPAC Name | (5Z)-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-5-[[3,5-diiodo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cccc(COc2c(I)cc(/C=C3\SC(=O)N(CC(=O)N4CCc5ccccc5C4)C3=O)cc2I)c1 |
| InChI | InChI=1S/C29H24I2N2O4S/c1-18-5-4-6-19(11-18)17-37-27-23(30)12-20(13-24(27)31)14-25-28(35)33(29(36)38-25)16-26(34)32-10-9-21-7-2-3-8-22(21)15-32/h2-8,11-14H,9-10,15-17H2,1H3/b25-14- |
| InChIKey | VOWBQFDHCZBOHO-QFEZKATASA-N |
| XLogP | 6.40 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.40 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|