C23H18I2N2O6S — CID 126374870
2-[4-[(Z)-[3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]acetic acid (PubChem CID 126374870) has the molecular formula C23H18I2N2O6S and a molecular weight of 704.28 g/mol. Its IUPAC name is 2-[4-[(Z)-[3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-[3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]acetic acid |
|---|---|
| PubChem CID | 126374870 |
| Molecular Formula | C23H18I2N2O6S |
| Molecular Weight | 704.28 g/mol |
| Exact Mass | 703.90 |
| IUPAC Name | 2-[4-[(Z)-[3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]acetic acid |
| SMILES | O=C(O)COc1c(I)cc(/C=C2\SC(=O)N(CC(=O)N3CCc4ccccc4C3)C2=O)cc1I |
| InChI | InChI=1S/C23H18I2N2O6S/c24-16-7-13(8-17(25)21(16)33-12-20(29)30)9-18-22(31)27(23(32)34-18)11-19(28)26-6-5-14-3-1-2-4-15(14)10-26/h1-4,7-9H,5-6,10-12H2,(H,29,30)/b18-9- |
| InChIKey | NGYPADIINSEWFB-NVMNQCDNSA-N |
| XLogP | 3.98 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.28 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|