C23H18BrIN2O6S — CID 126379637
2-[2-bromo-6-[(Z)-[3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-4-iodophenoxy]acetic acid (PubChem CID 126379637) has the molecular formula C23H18BrIN2O6S and a molecular weight of 657.28 g/mol. Its IUPAC name is 2-[2-bromo-6-[(Z)-[3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-4-iodophenoxy]acetic acid.
| Compound Name | 2-[2-bromo-6-[(Z)-[3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-4-iodophenoxy]acetic acid |
|---|---|
| PubChem CID | 126379637 |
| Molecular Formula | C23H18BrIN2O6S |
| Molecular Weight | 657.28 g/mol |
| Exact Mass | 655.91 |
| IUPAC Name | 2-[2-bromo-6-[(Z)-[3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-4-iodophenoxy]acetic acid |
| SMILES | O=C(O)COc1c(Br)cc(I)cc1/C=C1\SC(=O)N(CC(=O)N2CCc3ccccc3C2)C1=O |
| InChI | InChI=1S/C23H18BrIN2O6S/c24-17-9-16(25)7-15(21(17)33-12-20(29)30)8-18-22(31)27(23(32)34-18)11-19(28)26-6-5-13-3-1-2-4-14(13)10-26/h1-4,7-9H,5-6,10-12H2,(H,29,30)/b18-8- |
| InChIKey | DRCMVUDAAWHYCL-LSCVHKIXSA-N |
| XLogP | 4.14 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.28 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|