C21H16BrClN2O4S — CID 126382497
(5Z)-5-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126382497) has the molecular formula C21H16BrClN2O4S and a molecular weight of 507.79 g/mol. Its IUPAC name is (5Z)-5-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126382497 |
| Molecular Formula | C21H16BrClN2O4S |
| Molecular Weight | 507.79 g/mol |
| Exact Mass | 505.97 |
| IUPAC Name | (5Z)-5-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C\c2cc(Cl)cc(Br)c2O)C1=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C21H16BrClN2O4S/c22-16-9-15(23)7-14(19(16)27)8-17-20(28)25(21(29)30-17)11-18(26)24-6-5-12-3-1-2-4-13(12)10-24/h1-4,7-9,27H,5-6,10-11H2/b17-8- |
| InChIKey | KMNDGADRYAYPDX-IUXPMGMMSA-N |
| XLogP | 4.43 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.79 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|