C33H32N2O5S — CID 126281327
(5Z)-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126281327) has the molecular formula C33H32N2O5S and a molecular weight of 568.70 g/mol. Its IUPAC name is (5Z)-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126281327 |
| Molecular Formula | C33H32N2O5S |
| Molecular Weight | 568.70 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | (5Z)-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCc1cc(/C=C2\SC(=O)N(CC(=O)N3CCc4ccccc4C3)C2=O)cc(OCC)c1OCc1ccccc1 |
| InChI | InChI=1S/C33H32N2O5S/c1-3-10-26-17-24(18-28(39-4-2)31(26)40-22-23-11-6-5-7-12-23)19-29-32(37)35(33(38)41-29)21-30(36)34-16-15-25-13-8-9-14-27(25)20-34/h3,5-9,11-14,17-19H,1,4,10,15-16,20-22H2,2H3/b29-19- |
| InChIKey | SERVJJPVAYKLBU-CEUNXORHSA-N |
| XLogP | 6.01 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.70 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|