C26H27IN2O8S — CID 126102091
ethyl 2-[2-ethoxy-4-[(E)-[3-[2-(4-ethoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-iodophenoxy]acetate (PubChem CID 126102091) has the molecular formula C26H27IN2O8S and a molecular weight of 654.48 g/mol. Its IUPAC name is ethyl 2-[2-ethoxy-4-[(E)-[3-[2-(4-ethoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-iodophenoxy]acetate.
| Compound Name | ethyl 2-[2-ethoxy-4-[(E)-[3-[2-(4-ethoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-iodophenoxy]acetate |
|---|---|
| PubChem CID | 126102091 |
| Molecular Formula | C26H27IN2O8S |
| Molecular Weight | 654.48 g/mol |
| Exact Mass | 654.05 |
| IUPAC Name | ethyl 2-[2-ethoxy-4-[(E)-[3-[2-(4-ethoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-iodophenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(/C=C2/SC(=O)N(CC(=O)Nc3ccc(OCC)cc3)C2=O)cc1OCC |
| InChI | InChI=1S/C26H27IN2O8S/c1-4-34-18-9-7-17(8-10-18)28-22(30)14-29-25(32)21(38-26(29)33)13-16-11-19(27)24(20(12-16)35-5-2)37-15-23(31)36-6-3/h7-13H,4-6,14-15H2,1-3H3,(H,28,30)/b21-13+ |
| InChIKey | IQKMLCDOBRPKBE-FYJGNVAPSA-N |
| XLogP | 4.71 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|