C30H27ClFN3O7S — CID 126102425
2-[(5E)-5-[[3-chloro-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 126102425) has the molecular formula C30H27ClFN3O7S and a molecular weight of 628.08 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-chloro-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[3-chloro-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126102425 |
| Molecular Formula | C30H27ClFN3O7S |
| Molecular Weight | 628.08 g/mol |
| Exact Mass | 627.12 |
| IUPAC Name | 2-[(5E)-5-[[3-chloro-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CN2C(=O)S/C(=C/c3cc(Cl)c(OCC(=O)Nc4ccc(F)cc4)c(OCC)c3)C2=O)cc1 |
| InChI | InChI=1S/C30H27ClFN3O7S/c1-3-40-22-11-9-21(10-12-22)33-26(36)16-35-29(38)25(43-30(35)39)15-18-13-23(31)28(24(14-18)41-4-2)42-17-27(37)34-20-7-5-19(32)6-8-20/h5-15H,3-4,16-17H2,1-2H3,(H,33,36)(H,34,37)/b25-15+ |
| InChIKey | JOSRRXYTJBXWIK-MFKUBSTISA-N |
| XLogP | 5.97 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.08 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|