C23H20Cl2N2O7S — CID 126182275
ethyl 2-[2,6-dichloro-4-[(Z)-[3-[2-(4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 126182275) has the molecular formula C23H20Cl2N2O7S and a molecular weight of 539.39 g/mol. Its IUPAC name is ethyl 2-[2,6-dichloro-4-[(Z)-[3-[2-(4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2,6-dichloro-4-[(Z)-[3-[2-(4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126182275 |
| Molecular Formula | C23H20Cl2N2O7S |
| Molecular Weight | 539.39 g/mol |
| Exact Mass | 538.04 |
| IUPAC Name | ethyl 2-[2,6-dichloro-4-[(Z)-[3-[2-(4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(OC)cc3)C2=O)cc1Cl |
| InChI | InChI=1S/C23H20Cl2N2O7S/c1-3-33-20(29)12-34-21-16(24)8-13(9-17(21)25)10-18-22(30)27(23(31)35-18)11-19(28)26-14-4-6-15(32-2)7-5-14/h4-10H,3,11-12H2,1-2H3,(H,26,28)/b18-10- |
| InChIKey | WQNNYAIUKOLRNG-ZDLGFXPLSA-N |
| XLogP | 4.62 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|