C23H23ClN2O6S — CID 126252044
2-[(5E)-5-[(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 126252044) has the molecular formula C23H23ClN2O6S and a molecular weight of 490.97 g/mol. Its IUPAC name is 2-[(5E)-5-[(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126252044 |
| Molecular Formula | C23H23ClN2O6S |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 2-[(5E)-5-[(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN2C(=O)S/C(=C/c3cc(Cl)c(OC(C)C)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C23H23ClN2O6S/c1-13(2)32-21-17(24)9-14(10-18(21)31-4)11-19-22(28)26(23(29)33-19)12-20(27)25-15-5-7-16(30-3)8-6-15/h5-11,13H,12H2,1-4H3,(H,25,27)/b19-11+ |
| InChIKey | AANMRSBBNJGZSA-YBFXNURJSA-N |
| XLogP | 4.82 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|