C22H17BrCl2N2O6S — CID 126159339
ethyl 2-[4-[(Z)-[3-[2-(4-bromoanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-dichlorophenoxy]acetate (PubChem CID 126159339) has the molecular formula C22H17BrCl2N2O6S and a molecular weight of 588.26 g/mol. Its IUPAC name is ethyl 2-[4-[(Z)-[3-[2-(4-bromoanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-dichlorophenoxy]acetate.
| Compound Name | ethyl 2-[4-[(Z)-[3-[2-(4-bromoanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-dichlorophenoxy]acetate |
|---|---|
| PubChem CID | 126159339 |
| Molecular Formula | C22H17BrCl2N2O6S |
| Molecular Weight | 588.26 g/mol |
| Exact Mass | 585.94 |
| IUPAC Name | ethyl 2-[4-[(Z)-[3-[2-(4-bromoanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-dichlorophenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(Br)cc3)C2=O)cc1Cl |
| InChI | InChI=1S/C22H17BrCl2N2O6S/c1-2-32-19(29)11-33-20-15(24)7-12(8-16(20)25)9-17-21(30)27(22(31)34-17)10-18(28)26-14-5-3-13(23)4-6-14/h3-9H,2,10-11H2,1H3,(H,26,28)/b17-9- |
| InChIKey | KOTFCUVTRDEELA-MFOYZWKCSA-N |
| XLogP | 5.37 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.26 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|