C24H23IN2O7S2 — CID 126175940
methyl 2-[2-ethoxy-6-iodo-4-[(E)-[3-[2-(3-methylsulfanylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 126175940) has the molecular formula C24H23IN2O7S2 and a molecular weight of 642.49 g/mol. Its IUPAC name is methyl 2-[2-ethoxy-6-iodo-4-[(E)-[3-[2-(3-methylsulfanylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-ethoxy-6-iodo-4-[(E)-[3-[2-(3-methylsulfanylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126175940 |
| Molecular Formula | C24H23IN2O7S2 |
| Molecular Weight | 642.49 g/mol |
| Exact Mass | 642.00 |
| IUPAC Name | methyl 2-[2-ethoxy-6-iodo-4-[(E)-[3-[2-(3-methylsulfanylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)Nc3cccc(SC)c3)C2=O)cc(I)c1OCC(=O)OC |
| InChI | InChI=1S/C24H23IN2O7S2/c1-4-33-18-9-14(8-17(25)22(18)34-13-21(29)32-2)10-19-23(30)27(24(31)36-19)12-20(28)26-15-6-5-7-16(11-15)35-3/h5-11H,4,12-13H2,1-3H3,(H,26,28)/b19-10+ |
| InChIKey | QUHYAJWWUXJFBY-VXLYETTFSA-N |
| XLogP | 4.64 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|