C23H23IN2O5S2 — CID 126161047
2-[(5E)-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylsulfanylphenyl)acetamide (PubChem CID 126161047) has the molecular formula C23H23IN2O5S2 and a molecular weight of 598.48 g/mol. Its IUPAC name is 2-[(5E)-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 126161047 |
| Molecular Formula | C23H23IN2O5S2 |
| Molecular Weight | 598.48 g/mol |
| Exact Mass | 598.01 |
| IUPAC Name | 2-[(5E)-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylsulfanylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)Nc3cccc(SC)c3)C2=O)cc(I)c1OCC |
| InChI | InChI=1S/C23H23IN2O5S2/c1-4-30-18-10-14(9-17(24)21(18)31-5-2)11-19-22(28)26(23(29)33-19)13-20(27)25-15-7-6-8-16(12-15)32-3/h6-12H,4-5,13H2,1-3H3,(H,25,27)/b19-11+ |
| InChIKey | OKGCNHSHPLWRCZ-YBFXNURJSA-N |
| XLogP | 5.49 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|