C20H17BrN2O5S2 — CID 126156479
2-[(5E)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylsulfanylphenyl)acetamide (PubChem CID 126156479) has the molecular formula C20H17BrN2O5S2 and a molecular weight of 509.40 g/mol. Its IUPAC name is 2-[(5E)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 126156479 |
| Molecular Formula | C20H17BrN2O5S2 |
| Molecular Weight | 509.40 g/mol |
| Exact Mass | 507.98 |
| IUPAC Name | 2-[(5E)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylsulfanylphenyl)acetamide |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)Nc3cccc(SC)c3)C2=O)cc(Br)c1O |
| InChI | InChI=1S/C20H17BrN2O5S2/c1-28-15-7-11(6-14(21)18(15)25)8-16-19(26)23(20(27)30-16)10-17(24)22-12-4-3-5-13(9-12)29-2/h3-9,25H,10H2,1-2H3,(H,22,24)/b16-8+ |
| InChIKey | ASMZJVZWQDXANT-LZYBPNLTSA-N |
| XLogP | 4.56 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|