C26H19Br2ClN2O4S2 — CID 126171203
2-[(5E)-5-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylsulfanylphenyl)acetamide (PubChem CID 126171203) has the molecular formula C26H19Br2ClN2O4S2 and a molecular weight of 682.84 g/mol. Its IUPAC name is 2-[(5E)-5-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 126171203 |
| Molecular Formula | C26H19Br2ClN2O4S2 |
| Molecular Weight | 682.84 g/mol |
| Exact Mass | 679.88 |
| IUPAC Name | 2-[(5E)-5-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylsulfanylphenyl)acetamide |
| SMILES | CSc1cccc(NC(=O)CN2C(=O)S/C(=C/c3cc(Br)c(OCc4ccc(Cl)cc4)c(Br)c3)C2=O)c1 |
| InChI | InChI=1S/C26H19Br2ClN2O4S2/c1-36-19-4-2-3-18(12-19)30-23(32)13-31-25(33)22(37-26(31)34)11-16-9-20(27)24(21(28)10-16)35-14-15-5-7-17(29)8-6-15/h2-12H,13-14H2,1H3,(H,30,32)/b22-11+ |
| InChIKey | PQYZSIGCMYISJN-SSDVNMTOSA-N |
| XLogP | 7.84 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.84 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|