C29H26BrClN2O5S — CID 126339460
2-[(5E)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 126339460) has the molecular formula C29H26BrClN2O5S and a molecular weight of 629.96 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 126339460 |
| Molecular Formula | C29H26BrClN2O5S |
| Molecular Weight | 629.96 g/mol |
| Exact Mass | 628.04 |
| IUPAC Name | 2-[(5E)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccc(C(C)C)cc3)C2=O)cc(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H26BrClN2O5S/c1-17(2)20-6-10-22(11-7-20)32-26(34)15-33-28(35)25(39-29(33)36)14-19-12-23(30)27(24(13-19)37-3)38-16-18-4-8-21(31)9-5-18/h4-14,17H,15-16H2,1-3H3,(H,32,34)/b25-14+ |
| InChIKey | RVSMJACBFVDOOF-AFUMVMLFSA-N |
| XLogP | 7.49 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.96 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|