C27H21Br2ClN2O4S — CID 126186122
2-[(5E)-5-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4-dimethylphenyl)acetamide (PubChem CID 126186122) has the molecular formula C27H21Br2ClN2O4S and a molecular weight of 664.80 g/mol. Its IUPAC name is 2-[(5E)-5-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126186122 |
| Molecular Formula | C27H21Br2ClN2O4S |
| Molecular Weight | 664.80 g/mol |
| Exact Mass | 661.93 |
| IUPAC Name | 2-[(5E)-5-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)S/C(=C/c3cc(Br)c(OCc4ccc(Cl)cc4)c(Br)c3)C2=O)c(C)c1 |
| InChI | InChI=1S/C27H21Br2ClN2O4S/c1-15-3-8-22(16(2)9-15)31-24(33)13-32-26(34)23(37-27(32)35)12-18-10-20(28)25(21(29)11-18)36-14-17-4-6-19(30)7-5-17/h3-12H,13-14H2,1-2H3,(H,31,33)/b23-12+ |
| InChIKey | OLGOJWJCQVJEPL-FSJBWODESA-N |
| XLogP | 7.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.80 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|