C19H16BrClN2OS — CID 126093479
(5Z)-5-[(3-bromophenyl)methylidene]-2-(4-chlorophenyl)imino-3-propyl-1,3-thiazolidin-4-one (PubChem CID 126093479) has the molecular formula C19H16BrClN2OS and a molecular weight of 435.77 g/mol. Its IUPAC name is (5Z)-5-[(3-bromophenyl)methylidene]-2-(4-chlorophenyl)imino-3-propyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-bromophenyl)methylidene]-2-(4-chlorophenyl)imino-3-propyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126093479 |
| Molecular Formula | C19H16BrClN2OS |
| Molecular Weight | 435.77 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | (5Z)-5-[(3-bromophenyl)methylidene]-2-(4-chlorophenyl)imino-3-propyl-1,3-thiazolidin-4-one |
| SMILES | CCCN1C(=O)/C(=C/c2cccc(Br)c2)S/C1=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16BrClN2OS/c1-2-10-23-18(24)17(12-13-4-3-5-14(20)11-13)25-19(23)22-16-8-6-15(21)7-9-16/h3-9,11-12H,2,10H2,1H3/b17-12-,22-19+ |
| InChIKey | AQGNBVQOZABVKL-UKUDRTMLSA-N |
| XLogP | 6.12 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.77 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|