C26H20Cl3IN2O2S — CID 126099268
(5Z)-2-(4-chlorophenyl)imino-5-[[3,5-dichloro-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-3-propyl-1,3-thiazolidin-4-one (PubChem CID 126099268) has the molecular formula C26H20Cl3IN2O2S and a molecular weight of 657.79 g/mol. Its IUPAC name is (5Z)-2-(4-chlorophenyl)imino-5-[[3,5-dichloro-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-3-propyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-chlorophenyl)imino-5-[[3,5-dichloro-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-3-propyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126099268 |
| Molecular Formula | C26H20Cl3IN2O2S |
| Molecular Weight | 657.79 g/mol |
| Exact Mass | 655.94 |
| IUPAC Name | (5Z)-2-(4-chlorophenyl)imino-5-[[3,5-dichloro-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-3-propyl-1,3-thiazolidin-4-one |
| SMILES | CCCN1C(=O)/C(=C/c2cc(Cl)c(OCc3ccc(I)cc3)c(Cl)c2)S/C1=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H20Cl3IN2O2S/c1-2-11-32-25(33)23(35-26(32)31-20-9-5-18(27)6-10-20)14-17-12-21(28)24(22(29)13-17)34-15-16-3-7-19(30)8-4-16/h3-10,12-14H,2,11,15H2,1H3/b23-14-,31-26+ |
| InChIKey | WTAPKBSDPCUACI-HXQQERJRSA-N |
| XLogP | 8.84 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.79 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|