C27H20Cl3N3O2S — CID 126087995
2-[[2,6-dichloro-4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-3-propyl-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 126087995) has the molecular formula C27H20Cl3N3O2S and a molecular weight of 556.90 g/mol. Its IUPAC name is 2-[[2,6-dichloro-4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-3-propyl-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2,6-dichloro-4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-3-propyl-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126087995 |
| Molecular Formula | C27H20Cl3N3O2S |
| Molecular Weight | 556.90 g/mol |
| Exact Mass | 555.03 |
| IUPAC Name | 2-[[2,6-dichloro-4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-3-propyl-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | CCCN1C(=O)/C(=C/c2cc(Cl)c(OCc3ccccc3C#N)c(Cl)c2)S/C1=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H20Cl3N3O2S/c1-2-11-33-26(34)24(36-27(33)32-21-9-7-20(28)8-10-21)14-17-12-22(29)25(23(30)13-17)35-16-19-6-4-3-5-18(19)15-31/h3-10,12-14H,2,11,16H2,1H3/b24-14-,32-27+ |
| InChIKey | HIBSOKRSXKAEJU-JBGAJYKMSA-N |
| XLogP | 8.11 |
| TPSA | 65.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.90 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|