C27H19Cl2N3O4S — CID 4764864
methyl 4-[[5-[[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 4764864) has the molecular formula C27H19Cl2N3O4S and a molecular weight of 552.44 g/mol. Its IUPAC name is methyl 4-[[5-[[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | methyl 4-[[5-[[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 4764864 |
| Molecular Formula | C27H19Cl2N3O4S |
| Molecular Weight | 552.44 g/mol |
| Exact Mass | 551.05 |
| IUPAC Name | methyl 4-[[5-[[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | COC(=O)c1ccc(/N=C2/SC(=Cc3cc(Cl)c(OCc4ccccc4C#N)c(Cl)c3)C(=O)N2C)cc1 |
| InChI | InChI=1S/C27H19Cl2N3O4S/c1-32-25(33)23(37-27(32)31-20-9-7-17(8-10-20)26(34)35-2)13-16-11-21(28)24(22(29)12-16)36-15-19-6-4-3-5-18(19)14-30/h3-13H,15H2,1-2H3/b23-13?,31-27+ |
| InChIKey | ANCJHNCAOOQUTG-WMJAQWAJSA-N |
| XLogP | 6.46 |
| TPSA | 91.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.44 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|