C27H20ClN3O5S — CID 4772070
3-[[5-[[3-chloro-4-[(2-cyanophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 4772070) has the molecular formula C27H20ClN3O5S and a molecular weight of 533.99 g/mol. Its IUPAC name is 3-[[5-[[3-chloro-4-[(2-cyanophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[5-[[3-chloro-4-[(2-cyanophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 4772070 |
| Molecular Formula | C27H20ClN3O5S |
| Molecular Weight | 533.99 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | 3-[[5-[[3-chloro-4-[(2-cyanophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | COc1cc(C=C2S/C(=N/c3cccc(C(=O)O)c3)N(C)C2=O)cc(Cl)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C27H20ClN3O5S/c1-31-25(32)23(37-27(31)30-20-9-5-8-17(13-20)26(33)34)12-16-10-21(28)24(22(11-16)35-2)36-15-19-7-4-3-6-18(19)14-29/h3-13H,15H2,1-2H3,(H,33,34)/b23-12?,30-27+ |
| InChIKey | DPQPOVQQLQKCNE-QQWPKRBHSA-N |
| XLogP | 5.73 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.99 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|