C27H20ClN3O4S — CID 21228001
3-[[(5Z)-5-[[3-chloro-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 21228001) has the molecular formula C27H20ClN3O4S and a molecular weight of 517.99 g/mol. Its IUPAC name is 3-[[(5Z)-5-[[3-chloro-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5Z)-5-[[3-chloro-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 21228001 |
| Molecular Formula | C27H20ClN3O4S |
| Molecular Weight | 517.99 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | 3-[[(5Z)-5-[[3-chloro-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CCN1C(=O)/C(=C/c2ccc(OCc3ccccc3C#N)c(Cl)c2)S/C1=N/c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C27H20ClN3O4S/c1-2-31-25(32)24(36-27(31)30-21-9-5-8-18(14-21)26(33)34)13-17-10-11-23(22(28)12-17)35-16-20-7-4-3-6-19(20)15-29/h3-14H,2,16H2,1H3,(H,33,34)/b24-13-,30-27+ |
| InChIKey | MHMVMTVFEMGKEU-FWGBRMSSSA-N |
| XLogP | 6.11 |
| TPSA | 102.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.99 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|