C29H24IN3O5S — CID 21227933
3-[[(5Z)-5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 21227933) has the molecular formula C29H24IN3O5S and a molecular weight of 653.50 g/mol. Its IUPAC name is 3-[[(5Z)-5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5Z)-5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 21227933 |
| Molecular Formula | C29H24IN3O5S |
| Molecular Weight | 653.50 g/mol |
| Exact Mass | 653.05 |
| IUPAC Name | 3-[[(5Z)-5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CCOc1cc(/C=C2\S/C(=N/c3cccc(C(=O)O)c3)N(CC)C2=O)cc(I)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C29H24IN3O5S/c1-3-33-27(34)25(39-29(33)32-22-11-7-10-19(15-22)28(35)36)14-18-12-23(30)26(24(13-18)37-4-2)38-17-21-9-6-5-8-20(21)16-31/h5-15H,3-4,17H2,1-2H3,(H,35,36)/b25-14-,32-29+ |
| InChIKey | GFKYIKJVHKAONI-YXAPTUFUSA-N |
| XLogP | 6.46 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.50 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|