C27H21Cl2IN2O5S — CID 6208255
3-[[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 6208255) has the molecular formula C27H21Cl2IN2O5S and a molecular weight of 683.35 g/mol. Its IUPAC name is 3-[[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 6208255 |
| Molecular Formula | C27H21Cl2IN2O5S |
| Molecular Weight | 683.35 g/mol |
| Exact Mass | 681.96 |
| IUPAC Name | 3-[[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3cccc(C(=O)O)c3)N(C)C2=O)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H21Cl2IN2O5S/c1-3-36-22-10-15(9-21(30)24(22)37-14-17-7-8-18(28)13-20(17)29)11-23-25(33)32(2)27(38-23)31-19-6-4-5-16(12-19)26(34)35/h4-13H,3,14H2,1-2H3,(H,34,35)/b23-11+,31-27- |
| InChIKey | FERVVJDQXNHFJU-FJHCYZFTSA-N |
| XLogP | 7.51 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.35 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|