C28H24Cl2N2O5S — CID 6209201
3-[[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 6209201) has the molecular formula C28H24Cl2N2O5S and a molecular weight of 571.48 g/mol. Its IUPAC name is 3-[[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 6209201 |
| Molecular Formula | C28H24Cl2N2O5S |
| Molecular Weight | 571.48 g/mol |
| Exact Mass | 570.08 |
| IUPAC Name | 3-[[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3cccc(C(=O)O)c3)N(CC)C2=O)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H24Cl2N2O5S/c1-3-32-26(33)25(38-28(32)31-21-7-5-6-18(14-21)27(34)35)13-17-8-11-23(24(12-17)36-4-2)37-16-19-9-10-20(29)15-22(19)30/h5-15H,3-4,16H2,1-2H3,(H,34,35)/b25-13+,31-28- |
| InChIKey | YJCXNVJWXMLECY-BYRLOFTLSA-N |
| XLogP | 7.29 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.48 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|