C28H23Cl3N2O4S — CID 5132753
ethyl 3-[[5-[[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 5132753) has the molecular formula C28H23Cl3N2O4S and a molecular weight of 589.93 g/mol. Its IUPAC name is ethyl 3-[[5-[[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 3-[[5-[[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 5132753 |
| Molecular Formula | C28H23Cl3N2O4S |
| Molecular Weight | 589.93 g/mol |
| Exact Mass | 588.04 |
| IUPAC Name | ethyl 3-[[5-[[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(/N=C2\SC(=Cc3cc(Cl)ccc3OCc3ccc(Cl)cc3Cl)C(=O)N2CC)c1 |
| InChI | InChI=1S/C28H23Cl3N2O4S/c1-3-33-26(34)25(38-28(33)32-22-7-5-6-17(13-22)27(35)36-4-2)14-19-12-20(29)10-11-24(19)37-16-18-8-9-21(30)15-23(18)31/h5-15H,3-4,16H2,1-2H3/b25-14?,32-28- |
| InChIKey | RGCGCOZUSLMTKH-AZYFZWCNSA-N |
| XLogP | 8.03 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.93 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|