C28H25BrN2O4S — CID 3966353
ethyl 3-[[5-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 3966353) has the molecular formula C28H25BrN2O4S and a molecular weight of 565.49 g/mol. Its IUPAC name is ethyl 3-[[5-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 3-[[5-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 3966353 |
| Molecular Formula | C28H25BrN2O4S |
| Molecular Weight | 565.49 g/mol |
| Exact Mass | 564.07 |
| IUPAC Name | ethyl 3-[[5-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(/N=C2\SC(=Cc3ccccc3OCc3ccc(Br)cc3)C(=O)N2CC)c1 |
| InChI | InChI=1S/C28H25BrN2O4S/c1-3-31-26(32)25(36-28(31)30-23-10-7-9-21(16-23)27(33)34-4-2)17-20-8-5-6-11-24(20)35-18-19-12-14-22(29)15-13-19/h5-17H,3-4,18H2,1-2H3/b25-17?,30-28- |
| InChIKey | KIMSQMPGTPKUEV-WHWJCEGFSA-N |
| XLogP | 6.83 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.49 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|