C30H23BrN2O4S — CID 126067788
3-[[(5E)-5-[[2-[(4-bromophenyl)methoxy]naphthalen-1-yl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 126067788) has the molecular formula C30H23BrN2O4S and a molecular weight of 587.50 g/mol. Its IUPAC name is 3-[[(5E)-5-[[2-[(4-bromophenyl)methoxy]naphthalen-1-yl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5E)-5-[[2-[(4-bromophenyl)methoxy]naphthalen-1-yl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 126067788 |
| Molecular Formula | C30H23BrN2O4S |
| Molecular Weight | 587.50 g/mol |
| Exact Mass | 586.06 |
| IUPAC Name | 3-[[(5E)-5-[[2-[(4-bromophenyl)methoxy]naphthalen-1-yl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CCN1C(=O)/C(=C\c2c(OCc3ccc(Br)cc3)ccc3ccccc23)S/C1=N\c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C30H23BrN2O4S/c1-2-33-28(34)27(38-30(33)32-23-8-5-7-21(16-23)29(35)36)17-25-24-9-4-3-6-20(24)12-15-26(25)37-18-19-10-13-22(31)14-11-19/h3-17H,2,18H2,1H3,(H,35,36)/b27-17+,32-30- |
| InChIKey | WYLRDYKYFZYJHH-FLNDSNKGSA-N |
| XLogP | 7.50 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.50 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|