C28H25BrN2O5S — CID 21227919
3-[[(5Z)-5-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 21227919) has the molecular formula C28H25BrN2O5S and a molecular weight of 581.49 g/mol. Its IUPAC name is 3-[[(5Z)-5-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5Z)-5-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 21227919 |
| Molecular Formula | C28H25BrN2O5S |
| Molecular Weight | 581.49 g/mol |
| Exact Mass | 580.07 |
| IUPAC Name | 3-[[(5Z)-5-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CCOc1cc(/C=C2\S/C(=N/c3cccc(C(=O)O)c3)N(CC)C2=O)ccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C28H25BrN2O5S/c1-3-31-26(32)25(37-28(31)30-22-7-5-6-20(16-22)27(33)34)15-19-10-13-23(24(14-19)35-4-2)36-17-18-8-11-21(29)12-9-18/h5-16H,3-4,17H2,1-2H3,(H,33,34)/b25-15-,30-28+ |
| InChIKey | JOBWPZQJCNWMNW-UNAWRRCPSA-N |
| XLogP | 6.75 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.49 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|