C31H30BrN3O5S — CID 126161351
(5E)-5-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-ethyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one (PubChem CID 126161351) has the molecular formula C31H30BrN3O5S and a molecular weight of 636.57 g/mol. Its IUPAC name is (5E)-5-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-ethyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-ethyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126161351 |
| Molecular Formula | C31H30BrN3O5S |
| Molecular Weight | 636.57 g/mol |
| Exact Mass | 635.11 |
| IUPAC Name | (5E)-5-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-ethyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2ccc(OCc3ccc(Br)cc3)c(OC)c2)S/C1=N\c1cccc(C(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C31H30BrN3O5S/c1-3-35-30(37)28(18-22-9-12-26(27(17-22)38-2)40-20-21-7-10-24(32)11-8-21)41-31(35)33-25-6-4-5-23(19-25)29(36)34-13-15-39-16-14-34/h4-12,17-19H,3,13-16,20H2,1-2H3/b28-18+,33-31- |
| InChIKey | PNPQDCXPMRZBTH-ZISNPVPXSA-N |
| XLogP | 6.13 |
| TPSA | 80.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.57 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|