C30H28ClN3O4S — CID 126182150
(5E)-5-[[2-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one (PubChem CID 126182150) has the molecular formula C30H28ClN3O4S and a molecular weight of 562.09 g/mol. Its IUPAC name is (5E)-5-[[2-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[2-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126182150 |
| Molecular Formula | C30H28ClN3O4S |
| Molecular Weight | 562.09 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | (5E)-5-[[2-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2ccccc2OCc2ccc(Cl)cc2)S/C1=N/c1cccc(C(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C30H28ClN3O4S/c1-2-34-29(36)27(19-22-6-3-4-9-26(22)38-20-21-10-12-24(31)13-11-21)39-30(34)32-25-8-5-7-23(18-25)28(35)33-14-16-37-17-15-33/h3-13,18-19H,2,14-17,20H2,1H3/b27-19+,32-30+ |
| InChIKey | WGHGPHDPXAJXKW-VRACRKMDSA-N |
| XLogP | 6.02 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.09 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|